1 / 18

Acids Lesson 8 Application of Hydrolysis

Acids Lesson 8 Application of Hydrolysis. Application of Hydrolysis Tums CaCO 3 Basic Salt neutralizes stomach acid CaCO 3 ⇄ Ca 2+ + CO 3 2- CO 3 2- + HCl  HCO 3 - + Cl - HCO 3 - + HCl  H 2 CO 3 + Cl -. Application of Hydrolysis Salt and Vinegar Potato Chips

denzel
Download Presentation

Acids Lesson 8 Application of Hydrolysis

An Image/Link below is provided (as is) to download presentation Download Policy: Content on the Website is provided to you AS IS for your information and personal use and may not be sold / licensed / shared on other websites without getting consent from its author. Content is provided to you AS IS for your information and personal use only. Download presentation by click this link. While downloading, if for some reason you are not able to download a presentation, the publisher may have deleted the file from their server. During download, if you can't get a presentation, the file might be deleted by the publisher.

E N D

Presentation Transcript

  1. Acids Lesson 8 Application of Hydrolysis

  2. Application of Hydrolysis Tums CaCO3 Basic Salt neutralizes stomach acid CaCO3 ⇄ Ca2+ + CO32- CO32- + HCl  HCO3- + Cl- HCO3- + HCl  H2CO3+ Cl-

  3. Application of Hydrolysis Salt and Vinegar Potato Chips NaCH3COO(S)+C3H5O3COOH(S) + H3C6H5O7(S) Sodium acetate Malic acid Citric acid Basic Salt All of the above are solid and can be added in large quantity without making the chips soggy. NaCH3COO Na+ + CH3COO- CH3COO- + H2O ⇄ CH3COOH + OH- Malic and Citric acid increase the [H+], which lowers the [OH-], shifting the reaction to the right making more vinegar.

  4. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4

  5. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acid

  6. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2

  7. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2Acid Anhydride

  8. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2Acid AnhydrideSO2 + H2O  H2SO3

  9. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2Acid AnhydrideSO2 + H2O  H2SO3 H2SO3 ⇄ H+ + HSO3- Ca(OH)2

  10. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2Acid AnhydrideSO2 + H2O  H2SO3 H2SO3 ⇄ H+ + HSO3- Ca(OH)2 Weak Base

  11. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2Acid AnhydrideSO2 + H2O  H2SO3 H2SO3 ⇄ H+ + HSO3- Ca(OH)2 Weak BaseCa(OH)2⇄ Ca2+ + 2OH- H2CO3

  12. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2Acid AnhydrideSO2 + H2O  H2SO3 H2SO3 ⇄ H+ + HSO3- Ca(OH)2 Weak BaseCa(OH)2⇄ Ca2+ + 2OH- H2CO3Weak Acid

  13. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2Acid AnhydrideSO2 + H2O  H2SO3 H2SO3 ⇄ H+ + HSO3- Ca(OH)2 Weak BaseCa(OH)2⇄ Ca2+ + 2OH- H2CO3Weak Acid H2CO3 ⇄ H+ + HCO3- BaO

  14. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2Acid AnhydrideSO2 + H2O  H2SO3 H2SO3 ⇄ H+ + HSO3- Ca(OH)2 Weak BaseCa(OH)2⇄ Ca2+ + 2OH- H2CO3Weak Acid H2CO3 ⇄ H+ + HCO3- BaO Basic Anhydride

  15. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2Acid AnhydrideSO2 + H2O  H2SO3 H2SO3 ⇄ H+ + HSO3- Ca(OH)2 Weak BaseCa(OH)2⇄ Ca2+ + 2OH- H2CO3Weak Acid H2CO3 ⇄ H+ + HCO3- BaO Basic AnhydrideBaO + H2O  Ba(OH)2

  16. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. HClO4Strong acidHClO3 H+ + ClO4- SO2Acid AnhydrideSO2 + H2O  H2SO3 H2SO3 ⇄ H+ + HSO3- Ca(OH)2 Weak BaseCa(OH)2⇄ Ca2+ + 2OH- H2CO3Weak Acid H2CO3 ⇄ H+ + HCO3- BaO Basic AnhydrideBaO + H2O  Ba(OH)2 Ba(OH)2 Ba2+ + 2OH-

  17. Classify each formula and write an equation. strong acid weak acid strong base weak base acid anhydride basic anhydride. NaCN Basic SaltNaCN  Na+ + CN- CN- + H2O⇄ HCN + OH- KCl Neutral SaltKCl  K+ + Cl- CrCl3 Acid SaltCrCl3 Cr3+ + 3Cl- Cr(H20)63+ ⇄ H+ + Cr(H20)5(OH)2+

More Related